C21H23FN2O4S — CID 67159649
2-[5-fluoro-2-methyl-3-[[3-(propylsulfamoyl)phenyl]methyl]indol-1-yl]acetic acid (PubChem CID 67159649) has the molecular formula C21H23FN2O4S and a molecular weight of 418.49 g/mol. Its IUPAC name is 2-[5-fluoro-2-methyl-3-[[3-(propylsulfamoyl)phenyl]methyl]indol-1-yl]acetic acid.
| Compound Name | 2-[5-fluoro-2-methyl-3-[[3-(propylsulfamoyl)phenyl]methyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 67159649 |
| Molecular Formula | C21H23FN2O4S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-[5-fluoro-2-methyl-3-[[3-(propylsulfamoyl)phenyl]methyl]indol-1-yl]acetic acid |
| SMILES | CCCNS(=O)(=O)c1cccc(Cc2c(C)n(CC(=O)O)c3ccc(F)cc23)c1 |
| InChI | InChI=1S/C21H23FN2O4S/c1-3-9-23-29(27,28)17-6-4-5-15(10-17)11-18-14(2)24(13-21(25)26)20-8-7-16(22)12-19(18)20/h4-8,10,12,23H,3,9,11,13H2,1-2H3,(H,25,26) |
| InChIKey | ZPBFXCOEUXPALM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|