C22H23FN2O4S — CID 130433688
2-[5-fluoro-2-methyl-3-[3-[(4-methylphenyl)sulfonylamino]cyclobutyl]indol-1-yl]acetic acid (PubChem CID 130433688) has the molecular formula C22H23FN2O4S and a molecular weight of 430.50 g/mol. Its IUPAC name is 2-[5-fluoro-2-methyl-3-[3-[(4-methylphenyl)sulfonylamino]cyclobutyl]indol-1-yl]acetic acid.
| Compound Name | 2-[5-fluoro-2-methyl-3-[3-[(4-methylphenyl)sulfonylamino]cyclobutyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 130433688 |
| Molecular Formula | C22H23FN2O4S |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 2-[5-fluoro-2-methyl-3-[3-[(4-methylphenyl)sulfonylamino]cyclobutyl]indol-1-yl]acetic acid |
| SMILES | Cc1ccc(S(=O)(=O)NC2CC(c3c(C)n(CC(=O)O)c4ccc(F)cc34)C2)cc1 |
| InChI | InChI=1S/C22H23FN2O4S/c1-13-3-6-18(7-4-13)30(28,29)24-17-9-15(10-17)22-14(2)25(12-21(26)27)20-8-5-16(23)11-19(20)22/h3-8,11,15,17,24H,9-10,12H2,1-2H3,(H,26,27) |
| InChIKey | GCBUGJKTYKIUSE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|