C23H24F2N2O4S — CID 130433697
2-[5-fluoro-3-[1-(4-fluoro-2-methylphenyl)sulfonylpiperidin-4-yl]-2-methylindol-1-yl]acetic acid (PubChem CID 130433697) has the molecular formula C23H24F2N2O4S and a molecular weight of 462.52 g/mol. Its IUPAC name is 2-[5-fluoro-3-[1-(4-fluoro-2-methylphenyl)sulfonylpiperidin-4-yl]-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[5-fluoro-3-[1-(4-fluoro-2-methylphenyl)sulfonylpiperidin-4-yl]-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 130433697 |
| Molecular Formula | C23H24F2N2O4S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 2-[5-fluoro-3-[1-(4-fluoro-2-methylphenyl)sulfonylpiperidin-4-yl]-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)N1CCC(c2c(C)n(CC(=O)O)c3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C23H24F2N2O4S/c1-14-11-17(24)4-6-21(14)32(30,31)26-9-7-16(8-10-26)23-15(2)27(13-22(28)29)20-5-3-18(25)12-19(20)23/h3-6,11-12,16H,7-10,13H2,1-2H3,(H,28,29) |
| InChIKey | SYWSIMPVTNKSLJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|