C19H25FN2O2 — CID 130433726
2-[3-[4-(ethylamino)cyclohexyl]-5-fluoro-2-methylindol-1-yl]acetic acid (PubChem CID 130433726) has the molecular formula C19H25FN2O2 and a molecular weight of 332.42 g/mol. Its IUPAC name is 2-[3-[4-(ethylamino)cyclohexyl]-5-fluoro-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[3-[4-(ethylamino)cyclohexyl]-5-fluoro-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 130433726 |
| Molecular Formula | C19H25FN2O2 |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 2-[3-[4-(ethylamino)cyclohexyl]-5-fluoro-2-methylindol-1-yl]acetic acid |
| SMILES | CCNC1CCC(c2c(C)n(CC(=O)O)c3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C19H25FN2O2/c1-3-21-15-7-4-13(5-8-15)19-12(2)22(11-18(23)24)17-9-6-14(20)10-16(17)19/h6,9-10,13,15,21H,3-5,7-8,11H2,1-2H3,(H,23,24) |
| InChIKey | YNPMAZPIEZYUMF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|