C22H29FN2O3 — CID 130440217
methyl 2-[5-fluoro-2-methyl-3-[4-[methyl(propanoyl)amino]cyclohexyl]indol-1-yl]acetate (PubChem CID 130440217) has the molecular formula C22H29FN2O3 and a molecular weight of 388.48 g/mol. Its IUPAC name is methyl 2-[5-fluoro-2-methyl-3-[4-[methyl(propanoyl)amino]cyclohexyl]indol-1-yl]acetate.
| Compound Name | methyl 2-[5-fluoro-2-methyl-3-[4-[methyl(propanoyl)amino]cyclohexyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 130440217 |
| Molecular Formula | C22H29FN2O3 |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | methyl 2-[5-fluoro-2-methyl-3-[4-[methyl(propanoyl)amino]cyclohexyl]indol-1-yl]acetate |
| SMILES | CCC(=O)N(C)C1CCC(c2c(C)n(CC(=O)OC)c3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C22H29FN2O3/c1-5-20(26)24(3)17-9-6-15(7-10-17)22-14(2)25(13-21(27)28-4)19-11-8-16(23)12-18(19)22/h8,11-12,15,17H,5-7,9-10,13H2,1-4H3 |
| InChIKey | JQZGXNNHDHYFDO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|