C23H24FN3O3 — CID 130422447
2-[5-fluoro-2-methyl-3-[4-(pyridine-2-carbonylamino)cyclohexyl]indol-1-yl]acetic acid (PubChem CID 130422447) has the molecular formula C23H24FN3O3 and a molecular weight of 409.46 g/mol. Its IUPAC name is 2-[5-fluoro-2-methyl-3-[4-(pyridine-2-carbonylamino)cyclohexyl]indol-1-yl]acetic acid.
| Compound Name | 2-[5-fluoro-2-methyl-3-[4-(pyridine-2-carbonylamino)cyclohexyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 130422447 |
| Molecular Formula | C23H24FN3O3 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2-[5-fluoro-2-methyl-3-[4-(pyridine-2-carbonylamino)cyclohexyl]indol-1-yl]acetic acid |
| SMILES | Cc1c(C2CCC(NC(=O)c3ccccn3)CC2)c2cc(F)ccc2n1CC(=O)O |
| InChI | InChI=1S/C23H24FN3O3/c1-14-22(18-12-16(24)7-10-20(18)27(14)13-21(28)29)15-5-8-17(9-6-15)26-23(30)19-4-2-3-11-25-19/h2-4,7,10-12,15,17H,5-6,8-9,13H2,1H3,(H,26,30)(H,28,29) |
| InChIKey | WDXKJJJUMVXPAD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|