C21H28FNO2 — CID 130433721
methyl 2-[5-fluoro-2-methyl-3-(4-propylcyclohexyl)indol-1-yl]acetate (PubChem CID 130433721) has the molecular formula C21H28FNO2 and a molecular weight of 345.46 g/mol. Its IUPAC name is methyl 2-[5-fluoro-2-methyl-3-(4-propylcyclohexyl)indol-1-yl]acetate.
| Compound Name | methyl 2-[5-fluoro-2-methyl-3-(4-propylcyclohexyl)indol-1-yl]acetate |
|---|---|
| PubChem CID | 130433721 |
| Molecular Formula | C21H28FNO2 |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | methyl 2-[5-fluoro-2-methyl-3-(4-propylcyclohexyl)indol-1-yl]acetate |
| SMILES | CCCC1CCC(c2c(C)n(CC(=O)OC)c3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C21H28FNO2/c1-4-5-15-6-8-16(9-7-15)21-14(2)23(13-20(24)25-3)19-11-10-17(22)12-18(19)21/h10-12,15-16H,4-9,13H2,1-3H3 |
| InChIKey | NJZNYCKCYNJKQR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|