C25H29FN2O4S — CID 145030288
2-[5-fluoro-2-methyl-3-[1-(4-propan-2-yloxyphenyl)sulfinylpiperidin-4-yl]indol-1-yl]acetic acid (PubChem CID 145030288) has the molecular formula C25H29FN2O4S and a molecular weight of 472.58 g/mol. Its IUPAC name is 2-[5-fluoro-2-methyl-3-[1-(4-propan-2-yloxyphenyl)sulfinylpiperidin-4-yl]indol-1-yl]acetic acid.
| Compound Name | 2-[5-fluoro-2-methyl-3-[1-(4-propan-2-yloxyphenyl)sulfinylpiperidin-4-yl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 145030288 |
| Molecular Formula | C25H29FN2O4S |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 2-[5-fluoro-2-methyl-3-[1-(4-propan-2-yloxyphenyl)sulfinylpiperidin-4-yl]indol-1-yl]acetic acid |
| SMILES | Cc1c(C2CCN(S(=O)c3ccc(OC(C)C)cc3)CC2)c2cc(F)ccc2n1CC(=O)O |
| InChI | InChI=1S/C25H29FN2O4S/c1-16(2)32-20-5-7-21(8-6-20)33(31)27-12-10-18(11-13-27)25-17(3)28(15-24(29)30)23-9-4-19(26)14-22(23)25/h4-9,14,16,18H,10-13,15H2,1-3H3,(H,29,30) |
| InChIKey | JBSFEYFWODRYBW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|