C18H20N2O2 — CID 58923421
2-(3-cyclohexyl-6-isocyano-2-methylindol-1-yl)acetic acid (PubChem CID 58923421) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-(3-cyclohexyl-6-isocyano-2-methylindol-1-yl)acetic acid.
| Compound Name | 2-(3-cyclohexyl-6-isocyano-2-methylindol-1-yl)acetic acid |
|---|---|
| PubChem CID | 58923421 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-(3-cyclohexyl-6-isocyano-2-methylindol-1-yl)acetic acid |
| SMILES | [C-]#[N+]c1ccc2c(C3CCCCC3)c(C)n(CC(=O)O)c2c1 |
| InChI | InChI=1S/C18H20N2O2/c1-12-18(13-6-4-3-5-7-13)15-9-8-14(19-2)10-16(15)20(12)11-17(21)22/h8-10,13H,3-7,11H2,1H3,(H,21,22) |
| InChIKey | AURDODRJNDCTCS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 46.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|