C25H28N2O4 — CID 58923454
3-cyclohexyl-1-[2-(dimethylamino)-2-oxoethyl]-2-(3-hydroxyphenyl)indole-6-carboxylic acid (PubChem CID 58923454) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is 3-cyclohexyl-1-[2-(dimethylamino)-2-oxoethyl]-2-(3-hydroxyphenyl)indole-6-carboxylic acid.
| Compound Name | 3-cyclohexyl-1-[2-(dimethylamino)-2-oxoethyl]-2-(3-hydroxyphenyl)indole-6-carboxylic acid |
|---|---|
| PubChem CID | 58923454 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 3-cyclohexyl-1-[2-(dimethylamino)-2-oxoethyl]-2-(3-hydroxyphenyl)indole-6-carboxylic acid |
| SMILES | CN(C)C(=O)Cn1c(-c2cccc(O)c2)c(C2CCCCC2)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C25H28N2O4/c1-26(2)22(29)15-27-21-14-18(25(30)31)11-12-20(21)23(16-7-4-3-5-8-16)24(27)17-9-6-10-19(28)13-17/h6,9-14,16,28H,3-5,7-8,15H2,1-2H3,(H,30,31) |
| InChIKey | YXSZUYTVLGFDEK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |