C28H30FN3O2 — CID 130422541
methyl 2-[5-fluoro-2-methyl-3-[4-(quinolin-2-ylmethylamino)cyclohexyl]indol-1-yl]acetate (PubChem CID 130422541) has the molecular formula C28H30FN3O2 and a molecular weight of 459.57 g/mol. Its IUPAC name is methyl 2-[5-fluoro-2-methyl-3-[4-(quinolin-2-ylmethylamino)cyclohexyl]indol-1-yl]acetate.
| Compound Name | methyl 2-[5-fluoro-2-methyl-3-[4-(quinolin-2-ylmethylamino)cyclohexyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 130422541 |
| Molecular Formula | C28H30FN3O2 |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | methyl 2-[5-fluoro-2-methyl-3-[4-(quinolin-2-ylmethylamino)cyclohexyl]indol-1-yl]acetate |
| SMILES | COC(=O)Cn1c(C)c(C2CCC(NCc3ccc4ccccc4n3)CC2)c2cc(F)ccc21 |
| InChI | InChI=1S/C28H30FN3O2/c1-18-28(24-15-21(29)10-14-26(24)32(18)17-27(33)34-2)20-8-11-22(12-9-20)30-16-23-13-7-19-5-3-4-6-25(19)31-23/h3-7,10,13-15,20,22,30H,8-9,11-12,16-17H2,1-2H3 |
| InChIKey | NWEBEWJVZNKCLT-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|