C22H19FN2O4S2 — CID 67025766
methyl 2-[5-fluoro-2-methyl-3-[(3-pyridin-2-ylsulfonylthiophen-2-yl)methyl]indol-1-yl]acetate (PubChem CID 67025766) has the molecular formula C22H19FN2O4S2 and a molecular weight of 458.54 g/mol. Its IUPAC name is methyl 2-[5-fluoro-2-methyl-3-[(3-pyridin-2-ylsulfonylthiophen-2-yl)methyl]indol-1-yl]acetate.
| Compound Name | methyl 2-[5-fluoro-2-methyl-3-[(3-pyridin-2-ylsulfonylthiophen-2-yl)methyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 67025766 |
| Molecular Formula | C22H19FN2O4S2 |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | methyl 2-[5-fluoro-2-methyl-3-[(3-pyridin-2-ylsulfonylthiophen-2-yl)methyl]indol-1-yl]acetate |
| SMILES | COC(=O)Cn1c(C)c(Cc2sccc2S(=O)(=O)c2ccccn2)c2cc(F)ccc21 |
| InChI | InChI=1S/C22H19FN2O4S2/c1-14-16(17-11-15(23)6-7-18(17)25(14)13-22(26)29-2)12-19-20(8-10-30-19)31(27,28)21-5-3-4-9-24-21/h3-11H,12-13H2,1-2H3 |
| InChIKey | GMWQCCIDPSFSDH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|