C27H27ClN2O3 — CID 67150867
tert-butyl 2-[3-(1-benzyl-6-oxo-3-pyridinyl)-5-chloro-2-methylindol-1-yl]acetate (PubChem CID 67150867) has the molecular formula C27H27ClN2O3 and a molecular weight of 462.98 g/mol. Its IUPAC name is tert-butyl 2-[3-(1-benzyl-6-oxo-3-pyridinyl)-5-chloro-2-methylindol-1-yl]acetate.
| Compound Name | tert-butyl 2-[3-(1-benzyl-6-oxo-3-pyridinyl)-5-chloro-2-methylindol-1-yl]acetate |
|---|---|
| PubChem CID | 67150867 |
| Molecular Formula | C27H27ClN2O3 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | tert-butyl 2-[3-(1-benzyl-6-oxo-3-pyridinyl)-5-chloro-2-methylindol-1-yl]acetate |
| SMILES | Cc1c(-c2ccc(=O)n(Cc3ccccc3)c2)c2cc(Cl)ccc2n1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H27ClN2O3/c1-18-26(20-10-13-24(31)29(16-20)15-19-8-6-5-7-9-19)22-14-21(28)11-12-23(22)30(18)17-25(32)33-27(2,3)4/h5-14,16H,15,17H2,1-4H3 |
| InChIKey | RIBNGVJMDVJUHS-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |