C15H17BrFNO2 — CID 67150953
tert-butyl 2-(3-bromo-5-fluoro-2-methylindol-1-yl)acetate (PubChem CID 67150953) has the molecular formula C15H17BrFNO2 and a molecular weight of 342.21 g/mol. Its IUPAC name is tert-butyl 2-(3-bromo-5-fluoro-2-methylindol-1-yl)acetate.
| Compound Name | tert-butyl 2-(3-bromo-5-fluoro-2-methylindol-1-yl)acetate |
|---|---|
| PubChem CID | 67150953 |
| Molecular Formula | C15H17BrFNO2 |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | tert-butyl 2-(3-bromo-5-fluoro-2-methylindol-1-yl)acetate |
| SMILES | Cc1c(Br)c2cc(F)ccc2n1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H17BrFNO2/c1-9-14(16)11-7-10(17)5-6-12(11)18(9)8-13(19)20-15(2,3)4/h5-7H,8H2,1-4H3 |
| InChIKey | OTBBCCFZRJOQMO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |