C31H44FNO3Sn — CID 139804639
tert-butyl 2-(2-fluoro-9-oxo-6-tributylstannylacridin-10-yl)acetate (PubChem CID 139804639) has the molecular formula C31H44FNO3Sn and a molecular weight of 616.41 g/mol. Its IUPAC name is tert-butyl 2-(2-fluoro-9-oxo-6-tributylstannylacridin-10-yl)acetate.
| Compound Name | tert-butyl 2-(2-fluoro-9-oxo-6-tributylstannylacridin-10-yl)acetate |
|---|---|
| PubChem CID | 139804639 |
| Molecular Formula | C31H44FNO3Sn |
| Molecular Weight | 616.41 g/mol |
| Exact Mass | 617.23 |
| IUPAC Name | tert-butyl 2-(2-fluoro-9-oxo-6-tributylstannylacridin-10-yl)acetate |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc2c(=O)c3cc(F)ccc3n(CC(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C19H17FNO3.3C4H9.Sn/c1-19(2,3)24-17(22)11-21-15-7-5-4-6-13(15)18(23)14-10-12(20)8-9-16(14)21;3*1-3-4-2;/h4,6-10H,11H2,1-3H3;3*1,3-4H2,2H3; |
| InChIKey | BGUMLHFNCJKJIL-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.41 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|