C24H35FN2O4 — CID 90776712
tert-butyl N-[4-butoxy-2-(2,2-dimethylpropyl)-6-fluoro-1-oxoisoquinolin-3-yl]-N-methylcarbamate (PubChem CID 90776712) has the molecular formula C24H35FN2O4 and a molecular weight of 434.55 g/mol. Its IUPAC name is tert-butyl N-[4-butoxy-2-(2,2-dimethylpropyl)-6-fluoro-1-oxoisoquinolin-3-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-butoxy-2-(2,2-dimethylpropyl)-6-fluoro-1-oxoisoquinolin-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 90776712 |
| Molecular Formula | C24H35FN2O4 |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | tert-butyl N-[4-butoxy-2-(2,2-dimethylpropyl)-6-fluoro-1-oxoisoquinolin-3-yl]-N-methylcarbamate |
| SMILES | CCCCOc1c(N(C)C(=O)OC(C)(C)C)n(CC(C)(C)C)c(=O)c2ccc(F)cc12 |
| InChI | InChI=1S/C24H35FN2O4/c1-9-10-13-30-19-18-14-16(25)11-12-17(18)21(28)27(15-23(2,3)4)20(19)26(8)22(29)31-24(5,6)7/h11-12,14H,9-10,13,15H2,1-8H3 |
| InChIKey | RZDWAZAVKXPQRV-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|