C29H44N2O5 — CID 22175967
tert-butyl N-[[4-butoxy-6-cyclopentyloxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-3-yl]methyl]carbamate (PubChem CID 22175967) has the molecular formula C29H44N2O5 and a molecular weight of 500.68 g/mol. Its IUPAC name is tert-butyl N-[[4-butoxy-6-cyclopentyloxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-butoxy-6-cyclopentyloxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 22175967 |
| Molecular Formula | C29H44N2O5 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | tert-butyl N-[[4-butoxy-6-cyclopentyloxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-3-yl]methyl]carbamate |
| SMILES | CCCCOc1c(CNC(=O)OC(C)(C)C)n(CC(C)(C)C)c(=O)c2ccc(OC3CCCC3)cc12 |
| InChI | InChI=1S/C29H44N2O5/c1-8-9-16-34-25-23-17-21(35-20-12-10-11-13-20)14-15-22(23)26(32)31(19-28(2,3)4)24(25)18-30-27(33)36-29(5,6)7/h14-15,17,20H,8-13,16,18-19H2,1-7H3,(H,30,33) |
| InChIKey | XTZSVIIUFIKFBU-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|