C27H42N2O5 — CID 91038498
tert-butyl N-[4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-propoxyisoquinolin-3-yl]-N-methylcarbamate (PubChem CID 91038498) has the molecular formula C27H42N2O5 and a molecular weight of 474.64 g/mol. Its IUPAC name is tert-butyl N-[4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-propoxyisoquinolin-3-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-propoxyisoquinolin-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 91038498 |
| Molecular Formula | C27H42N2O5 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | tert-butyl N-[4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-propoxyisoquinolin-3-yl]-N-methylcarbamate |
| SMILES | CCCCOc1c(N(C)C(=O)OC(C)(C)C)n(CC(C)(C)C)c(=O)c2ccc(OCCC)cc12 |
| InChI | InChI=1S/C27H42N2O5/c1-10-12-16-33-22-21-17-19(32-15-11-2)13-14-20(21)24(30)29(18-26(3,4)5)23(22)28(9)25(31)34-27(6,7)8/h13-14,17H,10-12,15-16,18H2,1-9H3 |
| InChIKey | UESHCMITHABEDV-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|