C21H30N2O5 — CID 22176362
2-[3-(aminomethyl)-4-butoxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-6-yl]oxyacetic acid (PubChem CID 22176362) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is 2-[3-(aminomethyl)-4-butoxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-6-yl]oxyacetic acid.
| Compound Name | 2-[3-(aminomethyl)-4-butoxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-6-yl]oxyacetic acid |
|---|---|
| PubChem CID | 22176362 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 2-[3-(aminomethyl)-4-butoxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-6-yl]oxyacetic acid |
| SMILES | CCCCOc1c(CN)n(CC(C)(C)C)c(=O)c2ccc(OCC(=O)O)cc12 |
| InChI | InChI=1S/C21H30N2O5/c1-5-6-9-27-19-16-10-14(28-12-18(24)25)7-8-15(16)20(26)23(17(19)11-22)13-21(2,3)4/h7-8,10H,5-6,9,11-13,22H2,1-4H3,(H,24,25) |
| InChIKey | FBOPBYDKGLQTQV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|