C19H27FN2O2 — CID 22175737
3-(aminomethyl)-4-butoxy-2-(2,2-dimethylpropyl)-7-fluoroisoquinolin-1-one (PubChem CID 22175737) has the molecular formula C19H27FN2O2 and a molecular weight of 334.44 g/mol. Its IUPAC name is 3-(aminomethyl)-4-butoxy-2-(2,2-dimethylpropyl)-7-fluoroisoquinolin-1-one.
| Compound Name | 3-(aminomethyl)-4-butoxy-2-(2,2-dimethylpropyl)-7-fluoroisoquinolin-1-one |
|---|---|
| PubChem CID | 22175737 |
| Molecular Formula | C19H27FN2O2 |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 3-(aminomethyl)-4-butoxy-2-(2,2-dimethylpropyl)-7-fluoroisoquinolin-1-one |
| SMILES | CCCCOc1c(CN)n(CC(C)(C)C)c(=O)c2cc(F)ccc12 |
| InChI | InChI=1S/C19H27FN2O2/c1-5-6-9-24-17-14-8-7-13(20)10-15(14)18(23)22(16(17)11-21)12-19(2,3)4/h7-8,10H,5-6,9,11-12,21H2,1-4H3 |
| InChIKey | IKGLVMWVDWPTAO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|