C22H31NO4 — CID 22175574
ethyl 4-butoxy-2-(2,2-dimethylpropyl)-7-methyl-1-oxoisoquinoline-3-carboxylate (PubChem CID 22175574) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is ethyl 4-butoxy-2-(2,2-dimethylpropyl)-7-methyl-1-oxoisoquinoline-3-carboxylate.
| Compound Name | ethyl 4-butoxy-2-(2,2-dimethylpropyl)-7-methyl-1-oxoisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 22175574 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | ethyl 4-butoxy-2-(2,2-dimethylpropyl)-7-methyl-1-oxoisoquinoline-3-carboxylate |
| SMILES | CCCCOc1c(C(=O)OCC)n(CC(C)(C)C)c(=O)c2cc(C)ccc12 |
| InChI | InChI=1S/C22H31NO4/c1-7-9-12-27-19-16-11-10-15(3)13-17(16)20(24)23(14-22(4,5)6)18(19)21(25)26-8-2/h10-11,13H,7-9,12,14H2,1-6H3 |
| InChIKey | VDGGOGYMNYLQOS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|