C18H23Cl3N2O2 — CID 139967437
3-(aminomethyl)-4-butoxy-6,7-dichloro-2-(cyclopropylmethyl)isoquinolin-1-one;hydrochloride (PubChem CID 139967437) has the molecular formula C18H23Cl3N2O2 and a molecular weight of 405.75 g/mol. Its IUPAC name is 3-(aminomethyl)-4-butoxy-6,7-dichloro-2-(cyclopropylmethyl)isoquinolin-1-one;hydrochloride.
| Compound Name | 3-(aminomethyl)-4-butoxy-6,7-dichloro-2-(cyclopropylmethyl)isoquinolin-1-one;hydrochloride |
|---|---|
| PubChem CID | 139967437 |
| Molecular Formula | C18H23Cl3N2O2 |
| Molecular Weight | 405.75 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 3-(aminomethyl)-4-butoxy-6,7-dichloro-2-(cyclopropylmethyl)isoquinolin-1-one;hydrochloride |
| SMILES | CCCCOc1c(CN)n(CC2CC2)c(=O)c2cc(Cl)c(Cl)cc12.Cl |
| InChI | InChI=1S/C18H22Cl2N2O2.ClH/c1-2-3-6-24-17-12-7-14(19)15(20)8-13(12)18(23)22(16(17)9-21)10-11-4-5-11;/h7-8,11H,2-6,9-10,21H2,1H3;1H |
| InChIKey | ZRAFHUIUUJKNAI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.75 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|