C24H35N3O3 — CID 22175762
N-[3-(aminomethyl)-4-butoxy-2-(2-methylpropyl)-1-oxoisoquinolin-6-yl]cyclopentanecarboxamide (PubChem CID 22175762) has the molecular formula C24H35N3O3 and a molecular weight of 413.56 g/mol. Its IUPAC name is N-[3-(aminomethyl)-4-butoxy-2-(2-methylpropyl)-1-oxoisoquinolin-6-yl]cyclopentanecarboxamide.
| Compound Name | N-[3-(aminomethyl)-4-butoxy-2-(2-methylpropyl)-1-oxoisoquinolin-6-yl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 22175762 |
| Molecular Formula | C24H35N3O3 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | N-[3-(aminomethyl)-4-butoxy-2-(2-methylpropyl)-1-oxoisoquinolin-6-yl]cyclopentanecarboxamide |
| SMILES | CCCCOc1c(CN)n(CC(C)C)c(=O)c2ccc(NC(=O)C3CCCC3)cc12 |
| InChI | InChI=1S/C24H35N3O3/c1-4-5-12-30-22-20-13-18(26-23(28)17-8-6-7-9-17)10-11-19(20)24(29)27(15-16(2)3)21(22)14-25/h10-11,13,16-17H,4-9,12,14-15,25H2,1-3H3,(H,26,28) |
| InChIKey | IOXKXDHONMCDMP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|