C21H22N4O4 — CID 13302089
ethyl 10-(cyclohexanecarbonylamino)-4-oxopyrimido[1,2-c]quinazoline-3-carboxylate (PubChem CID 13302089) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is ethyl 10-(cyclohexanecarbonylamino)-4-oxopyrimido[1,2-c]quinazoline-3-carboxylate.
| Compound Name | ethyl 10-(cyclohexanecarbonylamino)-4-oxopyrimido[1,2-c]quinazoline-3-carboxylate |
|---|---|
| PubChem CID | 13302089 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | ethyl 10-(cyclohexanecarbonylamino)-4-oxopyrimido[1,2-c]quinazoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c3cc(NC(=O)C4CCCCC4)ccc3ncn2c1=O |
| InChI | InChI=1S/C21H22N4O4/c1-2-29-21(28)16-11-22-18-15-10-14(24-19(26)13-6-4-3-5-7-13)8-9-17(15)23-12-25(18)20(16)27/h8-13H,2-7H2,1H3,(H,24,26) |
| InChIKey | CWTXIBGKXMENRA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|