C18H19N3O3 — CID 13060540
ethyl 10-butyl-4-oxopyrimido[1,2-c]quinazoline-3-carboxylate (PubChem CID 13060540) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is ethyl 10-butyl-4-oxopyrimido[1,2-c]quinazoline-3-carboxylate.
| Compound Name | ethyl 10-butyl-4-oxopyrimido[1,2-c]quinazoline-3-carboxylate |
|---|---|
| PubChem CID | 13060540 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | ethyl 10-butyl-4-oxopyrimido[1,2-c]quinazoline-3-carboxylate |
| SMILES | CCCCc1ccc2ncn3c(=O)c(C(=O)OCC)cnc3c2c1 |
| InChI | InChI=1S/C18H19N3O3/c1-3-5-6-12-7-8-15-13(9-12)16-19-10-14(18(23)24-4-2)17(22)21(16)11-20-15/h7-11H,3-6H2,1-2H3 |
| InChIKey | NHYFCWPMNNPITD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|