C13H11N3O3S — CID 15415707
ethyl 3-methyl-10-oxo-5-thia-7,9,13-triazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7,11-pentaene-11-carboxylate (PubChem CID 15415707) has the molecular formula C13H11N3O3S and a molecular weight of 289.32 g/mol. Its IUPAC name is ethyl 3-methyl-10-oxo-5-thia-7,9,13-triazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7,11-pentaene-11-carboxylate.
| Compound Name | ethyl 3-methyl-10-oxo-5-thia-7,9,13-triazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7,11-pentaene-11-carboxylate |
|---|---|
| PubChem CID | 15415707 |
| Molecular Formula | C13H11N3O3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | ethyl 3-methyl-10-oxo-5-thia-7,9,13-triazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7,11-pentaene-11-carboxylate |
| SMILES | CCOC(=O)c1cnc2c3c(C)csc3ncn2c1=O |
| InChI | InChI=1S/C13H11N3O3S/c1-3-19-13(18)8-4-14-10-9-7(2)5-20-11(9)15-6-16(10)12(8)17/h4-6H,3H2,1-2H3 |
| InChIKey | FPIFEOSJTWNDBQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |