C10H9BrN2O3S — CID 22397189
ethyl 2-(bromomethyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 22397189) has the molecular formula C10H9BrN2O3S and a molecular weight of 317.16 g/mol. Its IUPAC name is ethyl 2-(bromomethyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 2-(bromomethyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 22397189 |
| Molecular Formula | C10H9BrN2O3S |
| Molecular Weight | 317.16 g/mol |
| Exact Mass | 315.95 |
| IUPAC Name | ethyl 2-(bromomethyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1cnc2sc(CBr)cn2c1=O |
| InChI | InChI=1S/C10H9BrN2O3S/c1-2-16-9(15)7-4-12-10-13(8(7)14)5-6(3-11)17-10/h4-5H,2-3H2,1H3 |
| InChIKey | HLHVPHYZPYNGMW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.16 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|