About ethyl 4-chlorothieno[2,3-d]pyrimidine-5-carboxylate
ethyl 4-chlorothieno[2,3-d]pyrimidine-5-carboxylate (PubChem CID 56687059) has the molecular formula C9H7ClN2O2S
and a molecular weight of 242.69 g/mol. Its IUPAC name is ethyl 4-chlorothieno[2,3-d]pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-chlorothieno[2,3-d]pyrimidine-5-carboxylate |
| PubChem CID | 56687059 |
| Molecular Formula | C9H7ClN2O2S |
| Molecular Weight | 242.69 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | ethyl 4-chlorothieno[2,3-d]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1csc2ncnc(Cl)c12 |
| InChI | InChI=1S/C9H7ClN2O2S/c1-2-14-9(13)5-3-15-8-6(5)7(10)11-4-12-8/h3-4H,2H2,1H3 |
| InChIKey | MHFSKNOBTNLWKM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.69 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-chlorothieno[2,3-d]pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-chlorothieno[2,3-d]pyrimidine-5-carboxylate?
The IUPAC name of ethyl 4-chlorothieno[2,3-d]pyrimidine-5-carboxylate (CID 56687059) is ethyl 4-chlorothieno[2,3-d]pyrimidine-5-carboxylate.
What is the SMILES notation for ethyl 4-chlorothieno[2,3-d]pyrimidine-5-carboxylate?
The canonical SMILES for ethyl 4-chlorothieno[2,3-d]pyrimidine-5-carboxylate is CCOC(=O)c1csc2ncnc(Cl)c12.
What is the InChIKey of ethyl 4-chlorothieno[2,3-d]pyrimidine-5-carboxylate?
The InChIKey is MHFSKNOBTNLWKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2O2S/c1-2-14-9(13)5-3-15-8-6(5)7(10)11-4-12-8/h3-4H,2H2,1H3.
What are the key properties of ethyl 4-chlorothieno[2,3-d]pyrimidine-5-carboxylate?
ethyl 4-chlorothieno[2,3-d]pyrimidine-5-carboxylate has a molecular weight of 242.69 g/mol, XLogP of 2.52, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-chlorothieno[2,3-d]pyrimidine-5-carboxylate is sourced from PubChem (CID 56687059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).