C9H8ClN3O2S — CID 82065924
ethyl 4-amino-2-chlorothieno[2,3-d]pyrimidine-5-carboxylate (PubChem CID 82065924) has the molecular formula C9H8ClN3O2S and a molecular weight of 257.70 g/mol. Its IUPAC name is ethyl 4-amino-2-chlorothieno[2,3-d]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-chlorothieno[2,3-d]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 82065924 |
| Molecular Formula | C9H8ClN3O2S |
| Molecular Weight | 257.70 g/mol |
| Exact Mass | 257.00 |
| IUPAC Name | ethyl 4-amino-2-chlorothieno[2,3-d]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1csc2nc(Cl)nc(N)c12 |
| InChI | InChI=1S/C9H8ClN3O2S/c1-2-15-8(14)4-3-16-7-5(4)6(11)12-9(10)13-7/h3H,2H2,1H3,(H2,11,12,13) |
| InChIKey | RYWYCKPVNXASPB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.70 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |