C12H11BrClNO2S — CID 174549944
ethyl 3-(2-bromoethyl)-4-chlorothieno[3,2-c]pyridine-7-carboxylate (PubChem CID 174549944) has the molecular formula C12H11BrClNO2S and a molecular weight of 348.65 g/mol. Its IUPAC name is ethyl 3-(2-bromoethyl)-4-chlorothieno[3,2-c]pyridine-7-carboxylate.
| Compound Name | ethyl 3-(2-bromoethyl)-4-chlorothieno[3,2-c]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 174549944 |
| Molecular Formula | C12H11BrClNO2S |
| Molecular Weight | 348.65 g/mol |
| Exact Mass | 346.94 |
| IUPAC Name | ethyl 3-(2-bromoethyl)-4-chlorothieno[3,2-c]pyridine-7-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)c2c(CCBr)csc12 |
| InChI | InChI=1S/C12H11BrClNO2S/c1-2-17-12(16)8-5-15-11(14)9-7(3-4-13)6-18-10(8)9/h5-6H,2-4H2,1H3 |
| InChIKey | YOPHPRPJFJIINY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.65 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|