C24H20ClNO3S2 — CID 87715581
ethyl 3-[(3-benzylphenoxy)-sulfanylmethyl]-4-chlorothieno[3,2-c]pyridine-7-carboxylate (PubChem CID 87715581) has the molecular formula C24H20ClNO3S2 and a molecular weight of 470.02 g/mol. Its IUPAC name is ethyl 3-[(3-benzylphenoxy)-sulfanylmethyl]-4-chlorothieno[3,2-c]pyridine-7-carboxylate.
| Compound Name | ethyl 3-[(3-benzylphenoxy)-sulfanylmethyl]-4-chlorothieno[3,2-c]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 87715581 |
| Molecular Formula | C24H20ClNO3S2 |
| Molecular Weight | 470.02 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | ethyl 3-[(3-benzylphenoxy)-sulfanylmethyl]-4-chlorothieno[3,2-c]pyridine-7-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)c2c(C(S)Oc3cccc(Cc4ccccc4)c3)csc12 |
| InChI | InChI=1S/C24H20ClNO3S2/c1-2-28-23(27)18-13-26-22(25)20-19(14-31-21(18)20)24(30)29-17-10-6-9-16(12-17)11-15-7-4-3-5-8-15/h3-10,12-14,24,30H,2,11H2,1H3 |
| InChIKey | VNRXPZDINQYEIA-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 48.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.02 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|