C24H18ClF2NO4S — CID 58832967
ethyl 4-chloro-3-[[3-[(2,4-difluorophenyl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridine-7-carboxylate (PubChem CID 58832967) has the molecular formula C24H18ClF2NO4S and a molecular weight of 489.93 g/mol. Its IUPAC name is ethyl 4-chloro-3-[[3-[(2,4-difluorophenyl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridine-7-carboxylate.
| Compound Name | ethyl 4-chloro-3-[[3-[(2,4-difluorophenyl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 58832967 |
| Molecular Formula | C24H18ClF2NO4S |
| Molecular Weight | 489.93 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | ethyl 4-chloro-3-[[3-[(2,4-difluorophenyl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridine-7-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)c2c(COc3cccc(OCc4ccc(F)cc4F)c3)csc12 |
| InChI | InChI=1S/C24H18ClF2NO4S/c1-2-30-24(29)19-10-28-23(25)21-15(13-33-22(19)21)12-32-18-5-3-4-17(9-18)31-11-14-6-7-16(26)8-20(14)27/h3-10,13H,2,11-12H2,1H3 |
| InChIKey | DGUZDMDIKFFJHU-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.93 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|