C24H22ClNO3S — CID 126695472
4-chloro-7-ethyl-3-[[3-[(4-methoxyphenyl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridine (PubChem CID 126695472) has the molecular formula C24H22ClNO3S and a molecular weight of 439.96 g/mol. Its IUPAC name is 4-chloro-7-ethyl-3-[[3-[(4-methoxyphenyl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridine.
| Compound Name | 4-chloro-7-ethyl-3-[[3-[(4-methoxyphenyl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 126695472 |
| Molecular Formula | C24H22ClNO3S |
| Molecular Weight | 439.96 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 4-chloro-7-ethyl-3-[[3-[(4-methoxyphenyl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridine |
| SMILES | CCc1cnc(Cl)c2c(COc3cccc(OCc4ccc(OC)cc4)c3)csc12 |
| InChI | InChI=1S/C24H22ClNO3S/c1-3-17-12-26-24(25)22-18(15-30-23(17)22)14-29-21-6-4-5-20(11-21)28-13-16-7-9-19(27-2)10-8-16/h4-12,15H,3,13-14H2,1-2H3 |
| InChIKey | RAPZMJKXJKQVHZ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.96 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|