About [4-amino-3-[[3-[(5-chlorothiophen-2-yl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridin-7-yl] ethyl carbonate
[4-amino-3-[[3-[(5-chlorothiophen-2-yl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridin-7-yl] ethyl carbonate (PubChem CID 126662730) has the molecular formula C22H19ClN2O5S2
and a molecular weight of 490.99 g/mol. Its IUPAC name is [4-amino-3-[[3-[(5-chlorothiophen-2-yl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridin-7-yl] ethyl carbonate.
Molecular Properties
| Compound Name | [4-amino-3-[[3-[(5-chlorothiophen-2-yl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridin-7-yl] ethyl carbonate |
| PubChem CID | 126662730 |
| Molecular Formula | C22H19ClN2O5S2 |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | [4-amino-3-[[3-[(5-chlorothiophen-2-yl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridin-7-yl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1cnc(N)c2c(COc3cccc(OCc4ccc(Cl)s4)c3)csc12 |
| InChI | InChI=1S/C22H19ClN2O5S2/c1-2-27-22(26)30-17-9-25-21(24)19-13(12-31-20(17)19)10-28-14-4-3-5-15(8-14)29-11-16-6-7-18(23)32-16/h3-9,12H,2,10-11H2,1H3,(H2,24,25) |
| InChIKey | QISJPRGYNMKLEX-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 92.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze [4-amino-3-[[3-[(5-chlorothiophen-2-yl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridin-7-yl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-amino-3-[[3-[(5-chlorothiophen-2-yl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridin-7-yl] ethyl carbonate?
The IUPAC name of [4-amino-3-[[3-[(5-chlorothiophen-2-yl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridin-7-yl] ethyl carbonate (CID 126662730) is [4-amino-3-[[3-[(5-chlorothiophen-2-yl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridin-7-yl] ethyl carbonate.
What is the SMILES notation for [4-amino-3-[[3-[(5-chlorothiophen-2-yl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridin-7-yl] ethyl carbonate?
The canonical SMILES for [4-amino-3-[[3-[(5-chlorothiophen-2-yl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridin-7-yl] ethyl carbonate is CCOC(=O)Oc1cnc(N)c2c(COc3cccc(OCc4ccc(Cl)s4)c3)csc12.
What is the InChIKey of [4-amino-3-[[3-[(5-chlorothiophen-2-yl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridin-7-yl] ethyl carbonate?
The InChIKey is QISJPRGYNMKLEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19ClN2O5S2/c1-2-27-22(26)30-17-9-25-21(24)19-13(12-31-20(17)19)10-28-14-4-3-5-15(8-14)29-11-16-6-7-18(23)32-16/h3-9,12H,2,10-11H2,1H3,(H2,24,25).
What are the key properties of [4-amino-3-[[3-[(5-chlorothiophen-2-yl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridin-7-yl] ethyl carbonate?
[4-amino-3-[[3-[(5-chlorothiophen-2-yl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridin-7-yl] ethyl carbonate has a molecular weight of 490.99 g/mol, XLogP of 6.29, 8 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [4-amino-3-[[3-[(5-chlorothiophen-2-yl)methoxy]phenoxy]methyl]thieno[3,2-c]pyridin-7-yl] ethyl carbonate is sourced from PubChem (CID 126662730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).