C21H18ClN3O4S — CID 87518037
ethyl 4-chloro-3-[[3-(5-ethyl-1,3,4-oxadiazol-2-yl)phenoxy]methyl]thieno[3,2-c]pyridine-7-carboxylate (PubChem CID 87518037) has the molecular formula C21H18ClN3O4S and a molecular weight of 443.91 g/mol. Its IUPAC name is ethyl 4-chloro-3-[[3-(5-ethyl-1,3,4-oxadiazol-2-yl)phenoxy]methyl]thieno[3,2-c]pyridine-7-carboxylate.
| Compound Name | ethyl 4-chloro-3-[[3-(5-ethyl-1,3,4-oxadiazol-2-yl)phenoxy]methyl]thieno[3,2-c]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 87518037 |
| Molecular Formula | C21H18ClN3O4S |
| Molecular Weight | 443.91 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | ethyl 4-chloro-3-[[3-(5-ethyl-1,3,4-oxadiazol-2-yl)phenoxy]methyl]thieno[3,2-c]pyridine-7-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)c2c(COc3cccc(-c4nnc(CC)o4)c3)csc12 |
| InChI | InChI=1S/C21H18ClN3O4S/c1-3-16-24-25-20(29-16)12-6-5-7-14(8-12)28-10-13-11-30-18-15(21(26)27-4-2)9-23-19(22)17(13)18/h5-9,11H,3-4,10H2,1-2H3 |
| InChIKey | CZAXDKNBXONYEH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 87.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.91 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|