C25H21Cl2NO4S — CID 86611391
ethyl 4-chloro-3-[[3-[2-(4-chlorophenyl)ethoxy]phenoxy]methyl]thieno[3,2-c]pyridine-7-carboxylate (PubChem CID 86611391) has the molecular formula C25H21Cl2NO4S and a molecular weight of 502.42 g/mol. Its IUPAC name is ethyl 4-chloro-3-[[3-[2-(4-chlorophenyl)ethoxy]phenoxy]methyl]thieno[3,2-c]pyridine-7-carboxylate.
| Compound Name | ethyl 4-chloro-3-[[3-[2-(4-chlorophenyl)ethoxy]phenoxy]methyl]thieno[3,2-c]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 86611391 |
| Molecular Formula | C25H21Cl2NO4S |
| Molecular Weight | 502.42 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | ethyl 4-chloro-3-[[3-[2-(4-chlorophenyl)ethoxy]phenoxy]methyl]thieno[3,2-c]pyridine-7-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)c2c(COc3cccc(OCCc4ccc(Cl)cc4)c3)csc12 |
| InChI | InChI=1S/C25H21Cl2NO4S/c1-2-30-25(29)21-13-28-24(27)22-17(15-33-23(21)22)14-32-20-5-3-4-19(12-20)31-11-10-16-6-8-18(26)9-7-16/h3-9,12-13,15H,2,10-11,14H2,1H3 |
| InChIKey | INSKVUYRGFDYIQ-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.42 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|