C23H15ClF3NO4S — CID 141166246
4-chloro-3-[[3-[[3-(trifluoromethyl)phenyl]methoxy]phenoxy]methyl]thieno[3,2-c]pyridine-7-carboxylic acid (PubChem CID 141166246) has the molecular formula C23H15ClF3NO4S and a molecular weight of 493.89 g/mol. Its IUPAC name is 4-chloro-3-[[3-[[3-(trifluoromethyl)phenyl]methoxy]phenoxy]methyl]thieno[3,2-c]pyridine-7-carboxylic acid.
| Compound Name | 4-chloro-3-[[3-[[3-(trifluoromethyl)phenyl]methoxy]phenoxy]methyl]thieno[3,2-c]pyridine-7-carboxylic acid |
|---|---|
| PubChem CID | 141166246 |
| Molecular Formula | C23H15ClF3NO4S |
| Molecular Weight | 493.89 g/mol |
| Exact Mass | 493.04 |
| IUPAC Name | 4-chloro-3-[[3-[[3-(trifluoromethyl)phenyl]methoxy]phenoxy]methyl]thieno[3,2-c]pyridine-7-carboxylic acid |
| SMILES | O=C(O)c1cnc(Cl)c2c(COc3cccc(OCc4cccc(C(F)(F)F)c4)c3)csc12 |
| InChI | InChI=1S/C23H15ClF3NO4S/c24-21-19-14(12-33-20(19)18(9-28-21)22(29)30)11-32-17-6-2-5-16(8-17)31-10-13-3-1-4-15(7-13)23(25,26)27/h1-9,12H,10-11H2,(H,29,30) |
| InChIKey | RKIINAHCXKUTSX-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.89 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|