C11H10N2O4S — CID 10945362
ethyl 3-formyl-6-oxo-2H-pyrimido[2,1-b][1,3]thiazine-7-carboxylate (PubChem CID 10945362) has the molecular formula C11H10N2O4S and a molecular weight of 266.28 g/mol. Its IUPAC name is ethyl 3-formyl-6-oxo-2H-pyrimido[2,1-b][1,3]thiazine-7-carboxylate.
| Compound Name | ethyl 3-formyl-6-oxo-2H-pyrimido[2,1-b][1,3]thiazine-7-carboxylate |
|---|---|
| PubChem CID | 10945362 |
| Molecular Formula | C11H10N2O4S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | ethyl 3-formyl-6-oxo-2H-pyrimido[2,1-b][1,3]thiazine-7-carboxylate |
| SMILES | CCOC(=O)c1cnc2n(c1=O)C=C(C=O)CS2 |
| InChI | InChI=1S/C11H10N2O4S/c1-2-17-10(16)8-3-12-11-13(9(8)15)4-7(5-14)6-18-11/h3-5H,2,6H2,1H3 |
| InChIKey | GCDLWCPWENWSMH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|