C10H13N3O4S — CID 7748533
ethyl 1-(2-amino-2-oxoethyl)-2-methylsulfanyl-6-oxopyrimidine-5-carboxylate (PubChem CID 7748533) has the molecular formula C10H13N3O4S and a molecular weight of 271.30 g/mol. Its IUPAC name is ethyl 1-(2-amino-2-oxoethyl)-2-methylsulfanyl-6-oxopyrimidine-5-carboxylate.
| Compound Name | ethyl 1-(2-amino-2-oxoethyl)-2-methylsulfanyl-6-oxopyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 7748533 |
| Molecular Formula | C10H13N3O4S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | ethyl 1-(2-amino-2-oxoethyl)-2-methylsulfanyl-6-oxopyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SC)n(CC(N)=O)c1=O |
| InChI | InChI=1S/C10H13N3O4S/c1-3-17-9(16)6-4-12-10(18-2)13(8(6)15)5-7(11)14/h4H,3,5H2,1-2H3,(H2,11,14) |
| InChIKey | ZUMVAWKVGXHJMA-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |