C20H23N3O5S — CID 7748722
ethyl 2-benzylsulfanyl-1-(2-morpholin-4-yl-2-oxoethyl)-6-oxopyrimidine-5-carboxylate (PubChem CID 7748722) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is ethyl 2-benzylsulfanyl-1-(2-morpholin-4-yl-2-oxoethyl)-6-oxopyrimidine-5-carboxylate.
| Compound Name | ethyl 2-benzylsulfanyl-1-(2-morpholin-4-yl-2-oxoethyl)-6-oxopyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 7748722 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | ethyl 2-benzylsulfanyl-1-(2-morpholin-4-yl-2-oxoethyl)-6-oxopyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SCc2ccccc2)n(CC(=O)N2CCOCC2)c1=O |
| InChI | InChI=1S/C20H23N3O5S/c1-2-28-19(26)16-12-21-20(29-14-15-6-4-3-5-7-15)23(18(16)25)13-17(24)22-8-10-27-11-9-22/h3-7,12H,2,8-11,13-14H2,1H3 |
| InChIKey | RPLLAWAAASILHS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |