C18H18N4O4 — CID 13060552
methyl 10-(2,2-dimethylpropanoylamino)-4-oxopyrimido[1,2-c]quinazoline-3-carboxylate (PubChem CID 13060552) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is methyl 10-(2,2-dimethylpropanoylamino)-4-oxopyrimido[1,2-c]quinazoline-3-carboxylate.
| Compound Name | methyl 10-(2,2-dimethylpropanoylamino)-4-oxopyrimido[1,2-c]quinazoline-3-carboxylate |
|---|---|
| PubChem CID | 13060552 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | methyl 10-(2,2-dimethylpropanoylamino)-4-oxopyrimido[1,2-c]quinazoline-3-carboxylate |
| SMILES | COC(=O)c1cnc2c3cc(NC(=O)C(C)(C)C)ccc3ncn2c1=O |
| InChI | InChI=1S/C18H18N4O4/c1-18(2,3)17(25)21-10-5-6-13-11(7-10)14-19-8-12(16(24)26-4)15(23)22(14)9-20-13/h5-9H,1-4H3,(H,21,25) |
| InChIKey | YEDSXSULLCBUSB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|