C20H20N4O4 — CID 13060557
methyl 10-(cyclohexanecarbonylamino)-4-oxopyrimido[1,2-c]quinazoline-3-carboxylate (PubChem CID 13060557) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is methyl 10-(cyclohexanecarbonylamino)-4-oxopyrimido[1,2-c]quinazoline-3-carboxylate.
| Compound Name | methyl 10-(cyclohexanecarbonylamino)-4-oxopyrimido[1,2-c]quinazoline-3-carboxylate |
|---|---|
| PubChem CID | 13060557 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | methyl 10-(cyclohexanecarbonylamino)-4-oxopyrimido[1,2-c]quinazoline-3-carboxylate |
| SMILES | COC(=O)c1cnc2c3cc(NC(=O)C4CCCCC4)ccc3ncn2c1=O |
| InChI | InChI=1S/C20H20N4O4/c1-28-20(27)15-10-21-17-14-9-13(23-18(25)12-5-3-2-4-6-12)7-8-16(14)22-11-24(17)19(15)26/h7-12H,2-6H2,1H3,(H,23,25) |
| InChIKey | YFRXIJHOLYFALY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|