C25H27N3O4 — CID 71818963
ethyl 5-(cyclohexanecarbonylamino)-1-(3-methylbenzoyl)indazole-3-carboxylate (PubChem CID 71818963) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is ethyl 5-(cyclohexanecarbonylamino)-1-(3-methylbenzoyl)indazole-3-carboxylate.
| Compound Name | ethyl 5-(cyclohexanecarbonylamino)-1-(3-methylbenzoyl)indazole-3-carboxylate |
|---|---|
| PubChem CID | 71818963 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | ethyl 5-(cyclohexanecarbonylamino)-1-(3-methylbenzoyl)indazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(C(=O)c2cccc(C)c2)c2ccc(NC(=O)C3CCCCC3)cc12 |
| InChI | InChI=1S/C25H27N3O4/c1-3-32-25(31)22-20-15-19(26-23(29)17-9-5-4-6-10-17)12-13-21(20)28(27-22)24(30)18-11-7-8-16(2)14-18/h7-8,11-15,17H,3-6,9-10H2,1-2H3,(H,26,29) |
| InChIKey | SPZFWGLIGJYXRE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |