C15H20Cl2N2O2 — CID 22175469
3-(aminomethyl)-4-butoxy-6-chloro-2-methylisoquinolin-1-one;hydrochloride (PubChem CID 22175469) has the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.24 g/mol. Its IUPAC name is 3-(aminomethyl)-4-butoxy-6-chloro-2-methylisoquinolin-1-one;hydrochloride.
| Compound Name | 3-(aminomethyl)-4-butoxy-6-chloro-2-methylisoquinolin-1-one;hydrochloride |
|---|---|
| PubChem CID | 22175469 |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 3-(aminomethyl)-4-butoxy-6-chloro-2-methylisoquinolin-1-one;hydrochloride |
| SMILES | CCCCOc1c(CN)n(C)c(=O)c2ccc(Cl)cc12.Cl |
| InChI | InChI=1S/C15H19ClN2O2.ClH/c1-3-4-7-20-14-12-8-10(16)5-6-11(12)15(19)18(2)13(14)9-17;/h5-6,8H,3-4,7,9,17H2,1-2H3;1H |
| InChIKey | LLPJTJTVJBBDJG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|