C17H20Cl3NO3 — CID 22176120
4-butoxy-6,7-dichloro-3-(chloromethyl)-2-(2-methoxyethyl)isoquinolin-1-one (PubChem CID 22176120) has the molecular formula C17H20Cl3NO3 and a molecular weight of 392.71 g/mol. Its IUPAC name is 4-butoxy-6,7-dichloro-3-(chloromethyl)-2-(2-methoxyethyl)isoquinolin-1-one.
| Compound Name | 4-butoxy-6,7-dichloro-3-(chloromethyl)-2-(2-methoxyethyl)isoquinolin-1-one |
|---|---|
| PubChem CID | 22176120 |
| Molecular Formula | C17H20Cl3NO3 |
| Molecular Weight | 392.71 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 4-butoxy-6,7-dichloro-3-(chloromethyl)-2-(2-methoxyethyl)isoquinolin-1-one |
| SMILES | CCCCOc1c(CCl)n(CCOC)c(=O)c2cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C17H20Cl3NO3/c1-3-4-6-24-16-11-8-13(19)14(20)9-12(11)17(22)21(5-7-23-2)15(16)10-18/h8-9H,3-7,10H2,1-2H3 |
| InChIKey | WRFZJHMNMOYPFB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.71 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|