C21H19Cl2NO4 — CID 22176025
2-benzyl-4-butoxy-6,7-dichloro-1-oxoisoquinoline-3-carboxylic acid (PubChem CID 22176025) has the molecular formula C21H19Cl2NO4 and a molecular weight of 420.29 g/mol. Its IUPAC name is 2-benzyl-4-butoxy-6,7-dichloro-1-oxoisoquinoline-3-carboxylic acid.
| Compound Name | 2-benzyl-4-butoxy-6,7-dichloro-1-oxoisoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 22176025 |
| Molecular Formula | C21H19Cl2NO4 |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 2-benzyl-4-butoxy-6,7-dichloro-1-oxoisoquinoline-3-carboxylic acid |
| SMILES | CCCCOc1c(C(=O)O)n(Cc2ccccc2)c(=O)c2cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C21H19Cl2NO4/c1-2-3-9-28-19-14-10-16(22)17(23)11-15(14)20(25)24(18(19)21(26)27)12-13-7-5-4-6-8-13/h4-8,10-11H,2-3,9,12H2,1H3,(H,26,27) |
| InChIKey | MQRMEMHRSQZVSK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|