C20H26Cl2N2O4 — CID 69364026
[6,7-dichloro-2-(2-methylpropyl)-1-oxo-4-pentoxyisoquinolin-3-yl]-methylcarbamic acid (PubChem CID 69364026) has the molecular formula C20H26Cl2N2O4 and a molecular weight of 429.34 g/mol. Its IUPAC name is [6,7-dichloro-2-(2-methylpropyl)-1-oxo-4-pentoxyisoquinolin-3-yl]-methylcarbamic acid.
| Compound Name | [6,7-dichloro-2-(2-methylpropyl)-1-oxo-4-pentoxyisoquinolin-3-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 69364026 |
| Molecular Formula | C20H26Cl2N2O4 |
| Molecular Weight | 429.34 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | [6,7-dichloro-2-(2-methylpropyl)-1-oxo-4-pentoxyisoquinolin-3-yl]-methylcarbamic acid |
| SMILES | CCCCCOc1c(N(C)C(=O)O)n(CC(C)C)c(=O)c2cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C20H26Cl2N2O4/c1-5-6-7-8-28-17-13-9-15(21)16(22)10-14(13)19(25)24(11-12(2)3)18(17)23(4)20(26)27/h9-10,12H,5-8,11H2,1-4H3,(H,26,27) |
| InChIKey | SBLCBUREJDQGNG-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.34 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|