C18H23Cl2NO3 — CID 22175866
4-butoxy-6,7-dichloro-3-(1-hydroxybutyl)-2-methylisoquinolin-1-one (PubChem CID 22175866) has the molecular formula C18H23Cl2NO3 and a molecular weight of 372.29 g/mol. Its IUPAC name is 4-butoxy-6,7-dichloro-3-(1-hydroxybutyl)-2-methylisoquinolin-1-one.
| Compound Name | 4-butoxy-6,7-dichloro-3-(1-hydroxybutyl)-2-methylisoquinolin-1-one |
|---|---|
| PubChem CID | 22175866 |
| Molecular Formula | C18H23Cl2NO3 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 4-butoxy-6,7-dichloro-3-(1-hydroxybutyl)-2-methylisoquinolin-1-one |
| SMILES | CCCCOc1c(C(O)CCC)n(C)c(=O)c2cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C18H23Cl2NO3/c1-4-6-8-24-17-11-9-13(19)14(20)10-12(11)18(23)21(3)16(17)15(22)7-5-2/h9-10,15,22H,4-8H2,1-3H3 |
| InChIKey | YXJQBPJOHFIWKH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|