C25H24Cl2N2O5 — CID 22175982
2-[[4-butoxy-6,7-dichloro-2-(2-methoxyethyl)-1-oxoisoquinolin-3-yl]methyl]isoindole-1,3-dione (PubChem CID 22175982) has the molecular formula C25H24Cl2N2O5 and a molecular weight of 503.38 g/mol. Its IUPAC name is 2-[[4-butoxy-6,7-dichloro-2-(2-methoxyethyl)-1-oxoisoquinolin-3-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-butoxy-6,7-dichloro-2-(2-methoxyethyl)-1-oxoisoquinolin-3-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 22175982 |
| Molecular Formula | C25H24Cl2N2O5 |
| Molecular Weight | 503.38 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | 2-[[4-butoxy-6,7-dichloro-2-(2-methoxyethyl)-1-oxoisoquinolin-3-yl]methyl]isoindole-1,3-dione |
| SMILES | CCCCOc1c(CN2C(=O)c3ccccc3C2=O)n(CCOC)c(=O)c2cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C25H24Cl2N2O5/c1-3-4-10-34-22-17-12-19(26)20(27)13-18(17)25(32)28(9-11-33-2)21(22)14-29-23(30)15-7-5-6-8-16(15)24(29)31/h5-8,12-13H,3-4,9-11,14H2,1-2H3 |
| InChIKey | KUMMWQBUBGCCPY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.38 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|