C25H24Cl2N2O4 — CID 69366220
2-[(4-butoxy-6,7-dichloro-1-oxo-2-propan-2-ylisoquinolin-3-yl)methyl]isoindole-1,3-dione (PubChem CID 69366220) has the molecular formula C25H24Cl2N2O4 and a molecular weight of 487.38 g/mol. Its IUPAC name is 2-[(4-butoxy-6,7-dichloro-1-oxo-2-propan-2-ylisoquinolin-3-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(4-butoxy-6,7-dichloro-1-oxo-2-propan-2-ylisoquinolin-3-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 69366220 |
| Molecular Formula | C25H24Cl2N2O4 |
| Molecular Weight | 487.38 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 2-[(4-butoxy-6,7-dichloro-1-oxo-2-propan-2-ylisoquinolin-3-yl)methyl]isoindole-1,3-dione |
| SMILES | CCCCOc1c(CN2C(=O)c3ccccc3C2=O)n(C(C)C)c(=O)c2cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C25H24Cl2N2O4/c1-4-5-10-33-22-17-11-19(26)20(27)12-18(17)25(32)29(14(2)3)21(22)13-28-23(30)15-8-6-7-9-16(15)24(28)31/h6-9,11-12,14H,4-5,10,13H2,1-3H3 |
| InChIKey | UWHGVSBORXTZLP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.38 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|